C18H19FN2O3 — CID 141026809
benzyl N-[3-(4-fluorophenyl)-1-(methylamino)-1-oxopropan-2-yl]carbamate (PubChem CID 141026809) has the molecular formula C18H19FN2O3 and a molecular weight of 330.36 g/mol. Its IUPAC name is benzyl N-[3-(4-fluorophenyl)-1-(methylamino)-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[3-(4-fluorophenyl)-1-(methylamino)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 141026809 |
| Molecular Formula | C18H19FN2O3 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | benzyl N-[3-(4-fluorophenyl)-1-(methylamino)-1-oxopropan-2-yl]carbamate |
| SMILES | CNC(=O)C(Cc1ccc(F)cc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H19FN2O3/c1-20-17(22)16(11-13-7-9-15(19)10-8-13)21-18(23)24-12-14-5-3-2-4-6-14/h2-10,16H,11-12H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | JOXVLIMECVRYQL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |