C20H20FNO4 — CID 59217778
benzyl N-[(2S)-3-(4-fluorophenyl)-1-[(2R)-2-methyloxiran-2-yl]-1-oxopropan-2-yl]carbamate (PubChem CID 59217778) has the molecular formula C20H20FNO4 and a molecular weight of 357.38 g/mol. Its IUPAC name is benzyl N-[(2S)-3-(4-fluorophenyl)-1-[(2R)-2-methyloxiran-2-yl]-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-3-(4-fluorophenyl)-1-[(2R)-2-methyloxiran-2-yl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 59217778 |
| Molecular Formula | C20H20FNO4 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | benzyl N-[(2S)-3-(4-fluorophenyl)-1-[(2R)-2-methyloxiran-2-yl]-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@]1(C(=O)[C@H](Cc2ccc(F)cc2)NC(=O)OCc2ccccc2)CO1 |
| InChI | InChI=1S/C20H20FNO4/c1-20(13-26-20)18(23)17(11-14-7-9-16(21)10-8-14)22-19(24)25-12-15-5-3-2-4-6-15/h2-10,17H,11-13H2,1H3,(H,22,24)/t17-,20+/m0/s1 |
| InChIKey | VHFRDPZQTDCQBM-FXAWDEMLSA-N |
| XLogP | 3.02 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|