C18H19N5O2 — CID 46881884
benzyl N-[(1S)-1-cyano-2-[4-(diaminomethylideneamino)phenyl]ethyl]carbamate (PubChem CID 46881884) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is benzyl N-[(1S)-1-cyano-2-[4-(diaminomethylideneamino)phenyl]ethyl]carbamate.
| Compound Name | benzyl N-[(1S)-1-cyano-2-[4-(diaminomethylideneamino)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 46881884 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | benzyl N-[(1S)-1-cyano-2-[4-(diaminomethylideneamino)phenyl]ethyl]carbamate |
| SMILES | N#C[C@H](Cc1ccc(N=C(N)N)cc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H19N5O2/c19-11-16(10-13-6-8-15(9-7-13)22-17(20)21)23-18(24)25-12-14-4-2-1-3-5-14/h1-9,16H,10,12H2,(H,23,24)(H4,20,21,22)/t16-/m0/s1 |
| InChIKey | LITMQKSVCWTOSP-INIZCTEOSA-N |
| XLogP | 1.95 |
| TPSA | 126.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|