C27H31N2O7P — CID 24748793
tert-butyl N-[4-[2-diphenoxyphosphoryl-2-(methoxycarbonylamino)ethyl]phenyl]carbamate (PubChem CID 24748793) has the molecular formula C27H31N2O7P and a molecular weight of 526.53 g/mol. Its IUPAC name is tert-butyl N-[4-[2-diphenoxyphosphoryl-2-(methoxycarbonylamino)ethyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-diphenoxyphosphoryl-2-(methoxycarbonylamino)ethyl]phenyl]carbamate |
|---|---|
| PubChem CID | 24748793 |
| Molecular Formula | C27H31N2O7P |
| Molecular Weight | 526.53 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | tert-butyl N-[4-[2-diphenoxyphosphoryl-2-(methoxycarbonylamino)ethyl]phenyl]carbamate |
| SMILES | COC(=O)NC(Cc1ccc(NC(=O)OC(C)(C)C)cc1)P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C27H31N2O7P/c1-27(2,3)34-26(31)28-21-17-15-20(16-18-21)19-24(29-25(30)33-4)37(32,35-22-11-7-5-8-12-22)36-23-13-9-6-10-14-23/h5-18,24H,19H2,1-4H3,(H,28,31)(H,29,30) |
| InChIKey | GJSNJFDVPPMFAQ-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.53 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|