C34H47N3O10 — CID 137162944
[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]phenyl] 2-(hydroxymethyl)-2-methyl-3-[2-methyl-2-[(4-methylphenyl)methoxy]propanoyl]oxypropanoate (PubChem CID 137162944) has the molecular formula C34H47N3O10 and a molecular weight of 657.76 g/mol. Its IUPAC name is [4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]phenyl] 2-(hydroxymethyl)-2-methyl-3-[2-methyl-2-[(4-methylphenyl)methoxy]propanoyl]oxypropanoate.
| Compound Name | [4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]phenyl] 2-(hydroxymethyl)-2-methyl-3-[2-methyl-2-[(4-methylphenyl)methoxy]propanoyl]oxypropanoate |
|---|---|
| PubChem CID | 137162944 |
| Molecular Formula | C34H47N3O10 |
| Molecular Weight | 657.76 g/mol |
| Exact Mass | 657.33 |
| IUPAC Name | [4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]phenyl] 2-(hydroxymethyl)-2-methyl-3-[2-methyl-2-[(4-methylphenyl)methoxy]propanoyl]oxypropanoate |
| SMILES | Cc1ccc(COC(C)(C)C(=O)OCC(C)(CO)C(=O)Oc2ccc(N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C34H47N3O10/c1-22-11-13-23(14-12-22)19-44-33(8,9)26(39)43-21-34(10,20-38)27(40)45-25-17-15-24(16-18-25)35-28(36-29(41)46-31(2,3)4)37-30(42)47-32(5,6)7/h11-18,38H,19-21H2,1-10H3,(H2,35,36,37,41,42) |
| InChIKey | ROKYDUWRIGDJJK-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 171.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.76 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|