C33H36ClN3O8 — CID 136611459
[2-chloro-4-(2-oxo-2-phenylmethoxyethyl)phenyl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate (PubChem CID 136611459) has the molecular formula C33H36ClN3O8 and a molecular weight of 638.12 g/mol. Its IUPAC name is [2-chloro-4-(2-oxo-2-phenylmethoxyethyl)phenyl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate.
| Compound Name | [2-chloro-4-(2-oxo-2-phenylmethoxyethyl)phenyl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate |
|---|---|
| PubChem CID | 136611459 |
| Molecular Formula | C33H36ClN3O8 |
| Molecular Weight | 638.12 g/mol |
| Exact Mass | 637.22 |
| IUPAC Name | [2-chloro-4-(2-oxo-2-phenylmethoxyethyl)phenyl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate |
| SMILES | CC(C)(C)OC(=O)NC(=Nc1ccc(C(=O)Oc2ccc(CC(=O)OCc3ccccc3)cc2Cl)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H36ClN3O8/c1-32(2,3)44-30(40)36-29(37-31(41)45-33(4,5)6)35-24-15-13-23(14-16-24)28(39)43-26-17-12-22(18-25(26)34)19-27(38)42-20-21-10-8-7-9-11-21/h7-18H,19-20H2,1-6H3,(H2,35,36,37,40,41) |
| InChIKey | YFXXLNPLKXGIAB-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 141.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.12 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|