C26H38F2N4O8 — CID 10816919
methyl 5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-(difluoromethyl)-2-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 10816919) has the molecular formula C26H38F2N4O8 and a molecular weight of 572.61 g/mol. Its IUPAC name is methyl 5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-(difluoromethyl)-2-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | methyl 5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-(difluoromethyl)-2-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 10816919 |
| Molecular Formula | C26H38F2N4O8 |
| Molecular Weight | 572.61 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | methyl 5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-(difluoromethyl)-2-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | COC(=O)C(CCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)(NC(=O)OCc1ccccc1)C(F)F |
| InChI | InChI=1S/C26H38F2N4O8/c1-24(2,3)39-21(34)30-20(31-22(35)40-25(4,5)6)29-15-11-14-26(18(27)28,19(33)37-7)32-23(36)38-16-17-12-9-8-10-13-17/h8-10,12-13,18H,11,14-16H2,1-7H3,(H,32,36)(H2,29,30,31,34,35) |
| InChIKey | HNAIPMCPHXVEIW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 153.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.61 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|