C38H58N4O7 — CID 91567472
benzyl (2S)-2-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexyl-methylamino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate (PubChem CID 91567472) has the molecular formula C38H58N4O7 and a molecular weight of 682.90 g/mol. Its IUPAC name is benzyl (2S)-2-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexyl-methylamino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate.
| Compound Name | benzyl (2S)-2-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexyl-methylamino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate |
|---|---|
| PubChem CID | 91567472 |
| Molecular Formula | C38H58N4O7 |
| Molecular Weight | 682.90 g/mol |
| Exact Mass | 682.43 |
| IUPAC Name | benzyl (2S)-2-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexyl-methylamino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate |
| SMILES | CN(CCCCCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)[C@@H](Cc1ccc(OC(C)(C)C)cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C38H58N4O7/c1-36(2,3)47-30-22-20-28(21-23-30)26-31(32(43)46-27-29-18-14-13-15-19-29)42(10)25-17-12-11-16-24-39-33(40-34(44)48-37(4,5)6)41-35(45)49-38(7,8)9/h13-15,18-23,31H,11-12,16-17,24-27H2,1-10H3,(H2,39,40,41,44,45)/t31-/m0/s1 |
| InChIKey | QNQZTEXFMQLLPF-HKBQPEDESA-N |
| XLogP | 7.42 |
| TPSA | 127.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.90 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|