C36H53N5O7 — CID 25216027
benzyl N-[(2S)-1-[8-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]octylamino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 25216027) has the molecular formula C36H53N5O7 and a molecular weight of 667.85 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[8-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]octylamino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[8-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]octylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 25216027 |
| Molecular Formula | C36H53N5O7 |
| Molecular Weight | 667.85 g/mol |
| Exact Mass | 667.39 |
| IUPAC Name | benzyl N-[(2S)-1-[8-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]octylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=NCCCCCCCCNC(=O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C36H53N5O7/c1-35(2,3)47-33(44)40-31(41-34(45)48-36(4,5)6)38-24-18-10-8-7-9-17-23-37-30(42)29(25-27-19-13-11-14-20-27)39-32(43)46-26-28-21-15-12-16-22-28/h11-16,19-22,29H,7-10,17-18,23-26H2,1-6H3,(H,37,42)(H,39,43)(H2,38,40,41,44,45)/t29-/m0/s1 |
| InChIKey | HIRPKMZFENNPLO-LJAQVGFWSA-N |
| XLogP | 6.39 |
| TPSA | 156.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.85 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|