C37H42N4O9 — CID 169006916
[(E)-4-oxo-4-phenylbut-2-en-2-yl] (2S)-5-[bis(phenylmethoxycarbonylamino)methylideneamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 169006916) has the molecular formula C37H42N4O9 and a molecular weight of 686.76 g/mol. Its IUPAC name is [(E)-4-oxo-4-phenylbut-2-en-2-yl] (2S)-5-[bis(phenylmethoxycarbonylamino)methylideneamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | [(E)-4-oxo-4-phenylbut-2-en-2-yl] (2S)-5-[bis(phenylmethoxycarbonylamino)methylideneamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 169006916 |
| Molecular Formula | C37H42N4O9 |
| Molecular Weight | 686.76 g/mol |
| Exact Mass | 686.30 |
| IUPAC Name | [(E)-4-oxo-4-phenylbut-2-en-2-yl] (2S)-5-[bis(phenylmethoxycarbonylamino)methylideneamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | C/C(=C\C(=O)c1ccccc1)OC(=O)[C@H](CCCN=C(NC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C37H42N4O9/c1-26(23-31(42)29-19-12-7-13-20-29)49-32(43)30(39-36(46)50-37(2,3)4)21-14-22-38-33(40-34(44)47-24-27-15-8-5-9-16-27)41-35(45)48-25-28-17-10-6-11-18-28/h5-13,15-20,23,30H,14,21-22,24-25H2,1-4H3,(H,39,46)(H2,38,40,41,44,45)/b26-23+/t30-/m0/s1 |
| InChIKey | KKXXGENIQGGWNP-DIQDIXSLSA-N |
| XLogP | 6.20 |
| TPSA | 170.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.76 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|