C21H21NO6 — CID 169006953
[(E)-4-oxo-4-phenylbut-2-en-2-yl] (2S)-3-hydroxy-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 169006953) has the molecular formula C21H21NO6 and a molecular weight of 383.40 g/mol. Its IUPAC name is [(E)-4-oxo-4-phenylbut-2-en-2-yl] (2S)-3-hydroxy-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | [(E)-4-oxo-4-phenylbut-2-en-2-yl] (2S)-3-hydroxy-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 169006953 |
| Molecular Formula | C21H21NO6 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | [(E)-4-oxo-4-phenylbut-2-en-2-yl] (2S)-3-hydroxy-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | C/C(=C\C(=O)c1ccccc1)OC(=O)[C@H](CO)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H21NO6/c1-15(12-19(24)17-10-6-3-7-11-17)28-20(25)18(13-23)22-21(26)27-14-16-8-4-2-5-9-16/h2-12,18,23H,13-14H2,1H3,(H,22,26)/b15-12+/t18-/m0/s1 |
| InChIKey | GCIOWESNCBARGP-XOVFHRFOSA-N |
| XLogP | 2.60 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|