C14H19NO7 — CID 54273519
benzyl N-[(2S,4R,5R)-1,4,5,6-tetrahydroxy-3-oxohexan-2-yl]carbamate (PubChem CID 54273519) has the molecular formula C14H19NO7 and a molecular weight of 313.31 g/mol. Its IUPAC name is benzyl N-[(2S,4R,5R)-1,4,5,6-tetrahydroxy-3-oxohexan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S,4R,5R)-1,4,5,6-tetrahydroxy-3-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 54273519 |
| Molecular Formula | C14H19NO7 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | benzyl N-[(2S,4R,5R)-1,4,5,6-tetrahydroxy-3-oxohexan-2-yl]carbamate |
| SMILES | O=C(N[C@@H](CO)C(=O)[C@H](O)[C@H](O)CO)OCc1ccccc1 |
| InChI | InChI=1S/C14H19NO7/c16-6-10(12(19)13(20)11(18)7-17)15-14(21)22-8-9-4-2-1-3-5-9/h1-5,10-11,13,16-18,20H,6-8H2,(H,15,21)/t10-,11+,13+/m0/s1 |
| InChIKey | RLUQNWAAUQGQGZ-DMDPSCGWSA-N |
| XLogP | -1.44 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |