C18H21NO4S — CID 58800085
benzyl N-[(3S)-3,4-dihydroxy-1-phenylsulfanylbutan-2-yl]carbamate (PubChem CID 58800085) has the molecular formula C18H21NO4S and a molecular weight of 347.44 g/mol. Its IUPAC name is benzyl N-[(3S)-3,4-dihydroxy-1-phenylsulfanylbutan-2-yl]carbamate.
| Compound Name | benzyl N-[(3S)-3,4-dihydroxy-1-phenylsulfanylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 58800085 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | benzyl N-[(3S)-3,4-dihydroxy-1-phenylsulfanylbutan-2-yl]carbamate |
| SMILES | O=C(NC(CSc1ccccc1)[C@H](O)CO)OCc1ccccc1 |
| InChI | InChI=1S/C18H21NO4S/c20-11-17(21)16(13-24-15-9-5-2-6-10-15)19-18(22)23-12-14-7-3-1-4-8-14/h1-10,16-17,20-21H,11-13H2,(H,19,22)/t16?,17-/m1/s1 |
| InChIKey | ZEEOVZCLSBTDKP-ZYMOGRSISA-N |
| XLogP | 2.43 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |