C24H25NO3S2 — CID 57193424
benzyl N-[(2S)-3-hydroxy-1,4-bis(phenylsulfanyl)butan-2-yl]carbamate (PubChem CID 57193424) has the molecular formula C24H25NO3S2 and a molecular weight of 439.60 g/mol. Its IUPAC name is benzyl N-[(2S)-3-hydroxy-1,4-bis(phenylsulfanyl)butan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-3-hydroxy-1,4-bis(phenylsulfanyl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 57193424 |
| Molecular Formula | C24H25NO3S2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | benzyl N-[(2S)-3-hydroxy-1,4-bis(phenylsulfanyl)butan-2-yl]carbamate |
| SMILES | O=C(N[C@H](CSc1ccccc1)C(O)CSc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C24H25NO3S2/c26-23(18-30-21-14-8-3-9-15-21)22(17-29-20-12-6-2-7-13-20)25-24(27)28-16-19-10-4-1-5-11-19/h1-15,22-23,26H,16-18H2,(H,25,27)/t22-,23?/m1/s1 |
| InChIKey | TWKMAQOKJLXLNU-WTQRLHSKSA-N |
| XLogP | 5.23 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |