C21H29NO3SSi — CID 125377098
benzyl N-[(2R,3R)-3-hydroxy-1-phenylsulfanyl-4-trimethylsilylbutan-2-yl]carbamate (PubChem CID 125377098) has the molecular formula C21H29NO3SSi and a molecular weight of 403.62 g/mol. Its IUPAC name is benzyl N-[(2R,3R)-3-hydroxy-1-phenylsulfanyl-4-trimethylsilylbutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R,3R)-3-hydroxy-1-phenylsulfanyl-4-trimethylsilylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 125377098 |
| Molecular Formula | C21H29NO3SSi |
| Molecular Weight | 403.62 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | benzyl N-[(2R,3R)-3-hydroxy-1-phenylsulfanyl-4-trimethylsilylbutan-2-yl]carbamate |
| SMILES | C[Si](C)(C)C[C@H](O)[C@H](CSc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H29NO3SSi/c1-27(2,3)16-20(23)19(15-26-18-12-8-5-9-13-18)22-21(24)25-14-17-10-6-4-7-11-17/h4-13,19-20,23H,14-16H2,1-3H3,(H,22,24)/t19-,20-/m0/s1 |
| InChIKey | LAOLRXLKHWRCHU-PMACEKPBSA-N |
| XLogP | 4.77 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.62 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|