C29H33N5O10 — CID 20603812
(2,5-dioxopyrrolidin-1-yl) 3-[bis(phenylmethoxycarbonylamino)methylideneamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 20603812) has the molecular formula C29H33N5O10 and a molecular weight of 611.61 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[bis(phenylmethoxycarbonylamino)methylideneamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[bis(phenylmethoxycarbonylamino)methylideneamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 20603812 |
| Molecular Formula | C29H33N5O10 |
| Molecular Weight | 611.61 g/mol |
| Exact Mass | 611.22 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[bis(phenylmethoxycarbonylamino)methylideneamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(C)(C)OC(=O)NC(CN=C(NC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C29H33N5O10/c1-29(2,3)43-28(40)31-21(24(37)44-34-22(35)14-15-23(34)36)16-30-25(32-26(38)41-17-19-10-6-4-7-11-19)33-27(39)42-18-20-12-8-5-9-13-20/h4-13,21H,14-18H2,1-3H3,(H,31,40)(H2,30,32,33,38,39) |
| InChIKey | XAMUMOBVABGXMC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 191.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.61 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|