C16H16N2O8 — CID 155286862
4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid (PubChem CID 155286862) has the molecular formula C16H16N2O8 and a molecular weight of 364.31 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid.
| Compound Name | 4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 155286862 |
| Molecular Formula | C16H16N2O8 |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid |
| SMILES | O=C(O)CC(NC(=O)OCc1ccccc1)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C16H16N2O8/c19-12-6-7-13(20)18(12)26-15(23)11(8-14(21)22)17-16(24)25-9-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,17,24)(H,21,22) |
| InChIKey | AGAPHGCWUMPSOU-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|