C19H21N3O8 — CID 167311537
(2,5-dioxopyrrolidin-1-yl) (2R)-2-(phenylmethoxycarbonylamino)-3-(prop-2-enoxycarbonylamino)propanoate (PubChem CID 167311537) has the molecular formula C19H21N3O8 and a molecular weight of 419.39 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (2R)-2-(phenylmethoxycarbonylamino)-3-(prop-2-enoxycarbonylamino)propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (2R)-2-(phenylmethoxycarbonylamino)-3-(prop-2-enoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 167311537 |
| Molecular Formula | C19H21N3O8 |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (2R)-2-(phenylmethoxycarbonylamino)-3-(prop-2-enoxycarbonylamino)propanoate |
| SMILES | C=CCOC(=O)NC[C@@H](NC(=O)OCc1ccccc1)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C19H21N3O8/c1-2-10-28-18(26)20-11-14(17(25)30-22-15(23)8-9-16(22)24)21-19(27)29-12-13-6-4-3-5-7-13/h2-7,14H,1,8-12H2,(H,20,26)(H,21,27)/t14-/m1/s1 |
| InChIKey | UAJJHKRQJRNVMR-CQSZACIVSA-N |
| XLogP | 0.80 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|