C20H22N2O8 — CID 167311522
1-O-benzyl 5-O-(2,5-dioxopyrrolidin-1-yl) (2R)-2-(prop-2-enoxycarbonylamino)pentanedioate (PubChem CID 167311522) has the molecular formula C20H22N2O8 and a molecular weight of 418.40 g/mol. Its IUPAC name is 1-O-benzyl 5-O-(2,5-dioxopyrrolidin-1-yl) (2R)-2-(prop-2-enoxycarbonylamino)pentanedioate.
| Compound Name | 1-O-benzyl 5-O-(2,5-dioxopyrrolidin-1-yl) (2R)-2-(prop-2-enoxycarbonylamino)pentanedioate |
|---|---|
| PubChem CID | 167311522 |
| Molecular Formula | C20H22N2O8 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 1-O-benzyl 5-O-(2,5-dioxopyrrolidin-1-yl) (2R)-2-(prop-2-enoxycarbonylamino)pentanedioate |
| SMILES | C=CCOC(=O)N[C@H](CCC(=O)ON1C(=O)CCC1=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H22N2O8/c1-2-12-28-20(27)21-15(19(26)29-13-14-6-4-3-5-7-14)8-11-18(25)30-22-16(23)9-10-17(22)24/h2-7,15H,1,8-13H2,(H,21,27)/t15-/m1/s1 |
| InChIKey | BYVUKHCSIBIEOW-OAHLLOKOSA-N |
| XLogP | 1.40 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|