C19H22N2O8 — CID 86734647
5-O-(2,5-dioxopyrrolidin-1-yl) 1-O-ethyl (2S)-2-(phenylmethoxycarbonylamino)pentanedioate (PubChem CID 86734647) has the molecular formula C19H22N2O8 and a molecular weight of 406.39 g/mol. Its IUPAC name is 5-O-(2,5-dioxopyrrolidin-1-yl) 1-O-ethyl (2S)-2-(phenylmethoxycarbonylamino)pentanedioate.
| Compound Name | 5-O-(2,5-dioxopyrrolidin-1-yl) 1-O-ethyl (2S)-2-(phenylmethoxycarbonylamino)pentanedioate |
|---|---|
| PubChem CID | 86734647 |
| Molecular Formula | C19H22N2O8 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 5-O-(2,5-dioxopyrrolidin-1-yl) 1-O-ethyl (2S)-2-(phenylmethoxycarbonylamino)pentanedioate |
| SMILES | CCOC(=O)[C@H](CCC(=O)ON1C(=O)CCC1=O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H22N2O8/c1-2-27-18(25)14(20-19(26)28-12-13-6-4-3-5-7-13)8-11-17(24)29-21-15(22)9-10-16(21)23/h3-7,14H,2,8-12H2,1H3,(H,20,26)/t14-/m0/s1 |
| InChIKey | YRGJSXOBCJQJOQ-AWEZNQCLSA-N |
| XLogP | 1.23 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|