C16H22N2O4 — CID 140590597
prop-2-enyl (2S)-4-(methylamino)-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 140590597) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is prop-2-enyl (2S)-4-(methylamino)-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | prop-2-enyl (2S)-4-(methylamino)-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 140590597 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | prop-2-enyl (2S)-4-(methylamino)-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | C=CCOC(=O)[C@H](CCNC)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H22N2O4/c1-3-11-21-15(19)14(9-10-17-2)18-16(20)22-12-13-7-5-4-6-8-13/h3-8,14,17H,1,9-12H2,2H3,(H,18,20)/t14-/m0/s1 |
| InChIKey | NFGPUVUDDXQKSB-AWEZNQCLSA-N |
| XLogP | 1.62 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|