C21H26NO7P — CID 139327227
benzyl (2R)-4-dimethoxyphosphoryl-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 139327227) has the molecular formula C21H26NO7P and a molecular weight of 435.41 g/mol. Its IUPAC name is benzyl (2R)-4-dimethoxyphosphoryl-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | benzyl (2R)-4-dimethoxyphosphoryl-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 139327227 |
| Molecular Formula | C21H26NO7P |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | benzyl (2R)-4-dimethoxyphosphoryl-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | COP(=O)(CC[C@@H](NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1)OC |
| InChI | InChI=1S/C21H26NO7P/c1-26-30(25,27-2)14-13-19(20(23)28-15-17-9-5-3-6-10-17)22-21(24)29-16-18-11-7-4-8-12-18/h3-12,19H,13-16H2,1-2H3,(H,22,24)/t19-/m1/s1 |
| InChIKey | ZCEMXILWKZGRLX-LJQANCHMSA-N |
| XLogP | 3.90 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|