C35H36NO9P — CID 139340136
benzyl (2R)-4-[methoxy-[3-(2-oxo-2-phenylmethoxyethyl)phenoxy]phosphoryl]-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 139340136) has the molecular formula C35H36NO9P and a molecular weight of 645.65 g/mol. Its IUPAC name is benzyl (2R)-4-[methoxy-[3-(2-oxo-2-phenylmethoxyethyl)phenoxy]phosphoryl]-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | benzyl (2R)-4-[methoxy-[3-(2-oxo-2-phenylmethoxyethyl)phenoxy]phosphoryl]-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 139340136 |
| Molecular Formula | C35H36NO9P |
| Molecular Weight | 645.65 g/mol |
| Exact Mass | 645.21 |
| IUPAC Name | benzyl (2R)-4-[methoxy-[3-(2-oxo-2-phenylmethoxyethyl)phenoxy]phosphoryl]-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | COP(=O)(CC[C@@H](NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1)Oc1cccc(CC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C35H36NO9P/c1-41-46(40,45-31-19-11-18-30(22-31)23-33(37)42-24-27-12-5-2-6-13-27)21-20-32(34(38)43-25-28-14-7-3-8-15-28)36-35(39)44-26-29-16-9-4-10-17-29/h2-19,22,32H,20-21,23-26H2,1H3,(H,36,39)/t32-,46?/m1/s1 |
| InChIKey | HAQUKZPKGNSETF-IRLYDPFISA-N |
| XLogP | 6.62 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.65 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|