C14H24NO7PS — CID 159381825
(2S)-2-amino-4-[[3-(carboxymethyl)phenoxy]-methoxyphosphoryl]butanoic acid;methane;sulfane (PubChem CID 159381825) has the molecular formula C14H24NO7PS and a molecular weight of 381.39 g/mol. Its IUPAC name is (2S)-2-amino-4-[[3-(carboxymethyl)phenoxy]-methoxyphosphoryl]butanoic acid;methane;sulfane.
| Compound Name | (2S)-2-amino-4-[[3-(carboxymethyl)phenoxy]-methoxyphosphoryl]butanoic acid;methane;sulfane |
|---|---|
| PubChem CID | 159381825 |
| Molecular Formula | C14H24NO7PS |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | (2S)-2-amino-4-[[3-(carboxymethyl)phenoxy]-methoxyphosphoryl]butanoic acid;methane;sulfane |
| SMILES | C.CO[P@@](=O)(CC[C@H](N)C(=O)O)Oc1cccc(CC(=O)O)c1.S |
| InChI | InChI=1S/C13H18NO7P.CH4.H2S/c1-20-22(19,6-5-11(14)13(17)18)21-10-4-2-3-9(7-10)8-12(15)16;;/h2-4,7,11H,5-6,8,14H2,1H3,(H,15,16)(H,17,18);1H4;1H2/t11-,22-;;/m0../s1 |
| InChIKey | LKZVPARKCREPDT-VXQADGGFSA-N |
| XLogP | 2.08 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|