C28H30NO9P — CID 91183304
2-[formyl(phenylmethoxy)amino]-4-[methoxy-[4-(2-oxo-2-phenylmethoxyethyl)phenoxy]phosphoryl]butanoic acid (PubChem CID 91183304) has the molecular formula C28H30NO9P and a molecular weight of 555.52 g/mol. Its IUPAC name is 2-[formyl(phenylmethoxy)amino]-4-[methoxy-[4-(2-oxo-2-phenylmethoxyethyl)phenoxy]phosphoryl]butanoic acid.
| Compound Name | 2-[formyl(phenylmethoxy)amino]-4-[methoxy-[4-(2-oxo-2-phenylmethoxyethyl)phenoxy]phosphoryl]butanoic acid |
|---|---|
| PubChem CID | 91183304 |
| Molecular Formula | C28H30NO9P |
| Molecular Weight | 555.52 g/mol |
| Exact Mass | 555.17 |
| IUPAC Name | 2-[formyl(phenylmethoxy)amino]-4-[methoxy-[4-(2-oxo-2-phenylmethoxyethyl)phenoxy]phosphoryl]butanoic acid |
| SMILES | COP(=O)(CCC(C(=O)O)N(C=O)OCc1ccccc1)Oc1ccc(CC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H30NO9P/c1-35-39(34,17-16-26(28(32)33)29(21-30)37-20-24-10-6-3-7-11-24)38-25-14-12-22(13-15-25)18-27(31)36-19-23-8-4-2-5-9-23/h2-15,21,26H,16-20H2,1H3,(H,32,33) |
| InChIKey | FYGCKFLJBWZMTR-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|