C29H34NO7P — CID 87063348
benzyl 4-[butoxy(phenoxy)phosphoryl]-2-[formyl(phenylmethoxy)amino]butanoate (PubChem CID 87063348) has the molecular formula C29H34NO7P and a molecular weight of 539.57 g/mol. Its IUPAC name is benzyl 4-[butoxy(phenoxy)phosphoryl]-2-[formyl(phenylmethoxy)amino]butanoate.
| Compound Name | benzyl 4-[butoxy(phenoxy)phosphoryl]-2-[formyl(phenylmethoxy)amino]butanoate |
|---|---|
| PubChem CID | 87063348 |
| Molecular Formula | C29H34NO7P |
| Molecular Weight | 539.57 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | benzyl 4-[butoxy(phenoxy)phosphoryl]-2-[formyl(phenylmethoxy)amino]butanoate |
| SMILES | CCCCOP(=O)(CCC(C(=O)OCc1ccccc1)N(C=O)OCc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C29H34NO7P/c1-2-3-20-36-38(33,37-27-17-11-6-12-18-27)21-19-28(29(32)34-22-25-13-7-4-8-14-25)30(24-31)35-23-26-15-9-5-10-16-26/h4-18,24,28H,2-3,19-23H2,1H3 |
| InChIKey | ALQZKFKVVZQJFI-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.57 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|