C20H24NO7P — CID 90804572
2-[formyl(phenylmethoxy)amino]-4-[methoxy-(4-methylphenoxy)phosphoryl]butanoic acid (PubChem CID 90804572) has the molecular formula C20H24NO7P and a molecular weight of 421.39 g/mol. Its IUPAC name is 2-[formyl(phenylmethoxy)amino]-4-[methoxy-(4-methylphenoxy)phosphoryl]butanoic acid.
| Compound Name | 2-[formyl(phenylmethoxy)amino]-4-[methoxy-(4-methylphenoxy)phosphoryl]butanoic acid |
|---|---|
| PubChem CID | 90804572 |
| Molecular Formula | C20H24NO7P |
| Molecular Weight | 421.39 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 2-[formyl(phenylmethoxy)amino]-4-[methoxy-(4-methylphenoxy)phosphoryl]butanoic acid |
| SMILES | COP(=O)(CCC(C(=O)O)N(C=O)OCc1ccccc1)Oc1ccc(C)cc1 |
| InChI | InChI=1S/C20H24NO7P/c1-16-8-10-18(11-9-16)28-29(25,26-2)13-12-19(20(23)24)21(15-22)27-14-17-6-4-3-5-7-17/h3-11,15,19H,12-14H2,1-2H3,(H,23,24) |
| InChIKey | UEWBJAQKQFYGLE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|