C26H27ClNO7P — CID 87063289
benzyl 4-[(4-chlorophenoxy)-methoxyphosphoryl]-2-[formyl(phenylmethoxy)amino]butanoate (PubChem CID 87063289) has the molecular formula C26H27ClNO7P and a molecular weight of 531.93 g/mol. Its IUPAC name is benzyl 4-[(4-chlorophenoxy)-methoxyphosphoryl]-2-[formyl(phenylmethoxy)amino]butanoate.
| Compound Name | benzyl 4-[(4-chlorophenoxy)-methoxyphosphoryl]-2-[formyl(phenylmethoxy)amino]butanoate |
|---|---|
| PubChem CID | 87063289 |
| Molecular Formula | C26H27ClNO7P |
| Molecular Weight | 531.93 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | benzyl 4-[(4-chlorophenoxy)-methoxyphosphoryl]-2-[formyl(phenylmethoxy)amino]butanoate |
| SMILES | COP(=O)(CCC(C(=O)OCc1ccccc1)N(C=O)OCc1ccccc1)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H27ClNO7P/c1-32-36(31,35-24-14-12-23(27)13-15-24)17-16-25(26(30)33-18-21-8-4-2-5-9-21)28(20-29)34-19-22-10-6-3-7-11-22/h2-15,20,25H,16-19H2,1H3 |
| InChIKey | UTNLKTKWQKASKF-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.93 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|