C20H31N3O5 — CID 122699028
[[(2R)-2-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]heptanoyl]amino]methylcarbamic acid (PubChem CID 122699028) has the molecular formula C20H31N3O5 and a molecular weight of 393.48 g/mol. Its IUPAC name is [[(2R)-2-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]heptanoyl]amino]methylcarbamic acid.
| Compound Name | [[(2R)-2-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]heptanoyl]amino]methylcarbamic acid |
|---|---|
| PubChem CID | 122699028 |
| Molecular Formula | C20H31N3O5 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | [[(2R)-2-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]heptanoyl]amino]methylcarbamic acid |
| SMILES | CCCCC[C@@H](C(=O)NCNC(=O)O)[C@@H](CC)N(C=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H31N3O5/c1-3-5-7-12-17(19(25)21-14-22-20(26)27)18(4-2)23(15-24)28-13-16-10-8-6-9-11-16/h6,8-11,15,17-18,22H,3-5,7,12-14H2,1-2H3,(H,21,25)(H,26,27)/t17-,18-/m1/s1 |
| InChIKey | YARXDUSAJMAFGX-QZTJIDSGSA-N |
| XLogP | 2.89 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|