C34H42FN3O6 — CID 144883960
2-[2-fluoro-5-[4-[[2-[1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methylcarbamoyl]-5-methylcyclopenta-1,3-dien-1-yl]phenyl]acetic acid (PubChem CID 144883960) has the molecular formula C34H42FN3O6 and a molecular weight of 607.72 g/mol. Its IUPAC name is 2-[2-fluoro-5-[4-[[2-[1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methylcarbamoyl]-5-methylcyclopenta-1,3-dien-1-yl]phenyl]acetic acid.
| Compound Name | 2-[2-fluoro-5-[4-[[2-[1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methylcarbamoyl]-5-methylcyclopenta-1,3-dien-1-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 144883960 |
| Molecular Formula | C34H42FN3O6 |
| Molecular Weight | 607.72 g/mol |
| Exact Mass | 607.31 |
| IUPAC Name | 2-[2-fluoro-5-[4-[[2-[1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methylcarbamoyl]-5-methylcyclopenta-1,3-dien-1-yl]phenyl]acetic acid |
| SMILES | CCCCCC(C(=O)NCNC(=O)C1=CC=C(c2ccc(F)c(CC(=O)O)c2)C1C)C(CC)N(C=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H42FN3O6/c1-4-6-8-13-29(31(5-2)38(22-39)44-20-24-11-9-7-10-12-24)34(43)37-21-36-33(42)28-16-15-27(23(28)3)25-14-17-30(35)26(18-25)19-32(40)41/h7,9-12,14-18,22-23,29,31H,4-6,8,13,19-21H2,1-3H3,(H,36,42)(H,37,43)(H,40,41) |
| InChIKey | WNYAVKZFSKNIKN-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.72 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|