C34H43N3O7 — CID 144883801
5-(3-acetyl-5-ethoxyphenyl)-N-[[[(2R)-2-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]heptanoyl]amino]methyl]furan-2-carboxamide (PubChem CID 144883801) has the molecular formula C34H43N3O7 and a molecular weight of 605.73 g/mol. Its IUPAC name is 5-(3-acetyl-5-ethoxyphenyl)-N-[[[(2R)-2-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]heptanoyl]amino]methyl]furan-2-carboxamide.
| Compound Name | 5-(3-acetyl-5-ethoxyphenyl)-N-[[[(2R)-2-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]heptanoyl]amino]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 144883801 |
| Molecular Formula | C34H43N3O7 |
| Molecular Weight | 605.73 g/mol |
| Exact Mass | 605.31 |
| IUPAC Name | 5-(3-acetyl-5-ethoxyphenyl)-N-[[[(2R)-2-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]heptanoyl]amino]methyl]furan-2-carboxamide |
| SMILES | CCCCC[C@@H](C(=O)NCNC(=O)c1ccc(-c2cc(OCC)cc(C(C)=O)c2)o1)[C@@H](CC)N(C=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H43N3O7/c1-5-8-10-15-29(30(6-2)37(23-38)43-21-25-13-11-9-12-14-25)33(40)35-22-36-34(41)32-17-16-31(44-32)27-18-26(24(4)39)19-28(20-27)42-7-3/h9,11-14,16-20,23,29-30H,5-8,10,15,21-22H2,1-4H3,(H,35,40)(H,36,41)/t29-,30-/m1/s1 |
| InChIKey | PLRCVPGXIQJSFU-LOYHVIPDSA-N |
| XLogP | 5.92 |
| TPSA | 127.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.73 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|