C39H50N4O11 — CID 146176545
dimethyl 2-[[3-ethoxy-5-[5-[[2-[1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]butanedioate (PubChem CID 146176545) has the molecular formula C39H50N4O11 and a molecular weight of 750.85 g/mol. Its IUPAC name is dimethyl 2-[[3-ethoxy-5-[5-[[2-[1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]butanedioate.
| Compound Name | dimethyl 2-[[3-ethoxy-5-[5-[[2-[1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]butanedioate |
|---|---|
| PubChem CID | 146176545 |
| Molecular Formula | C39H50N4O11 |
| Molecular Weight | 750.85 g/mol |
| Exact Mass | 750.35 |
| IUPAC Name | dimethyl 2-[[3-ethoxy-5-[5-[[2-[1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]butanedioate |
| SMILES | CCCCCC(C(=O)NCNC(=O)c1ccc(-c2cc(OCC)cc(C(=O)NC(CC(=O)OC)C(=O)OC)c2)o1)C(CC)N(C=O)OCc1ccccc1 |
| InChI | InChI=1S/C39H50N4O11/c1-6-9-11-16-30(32(7-2)43(25-44)53-23-26-14-12-10-13-15-26)37(47)40-24-41-38(48)34-18-17-33(54-34)27-19-28(21-29(20-27)52-8-3)36(46)42-31(39(49)51-5)22-35(45)50-4/h10,12-15,17-21,25,30-32H,6-9,11,16,22-24H2,1-5H3,(H,40,47)(H,41,48)(H,42,46) |
| InChIKey | YMBFBJFWTCCLHK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 191.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.85 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|