C32H41N3O7 — CID 122699085
5-(3-ethoxy-5-hydroxyphenyl)-N-[[2-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methyl]furan-2-carboxamide (PubChem CID 122699085) has the molecular formula C32H41N3O7 and a molecular weight of 579.69 g/mol. Its IUPAC name is 5-(3-ethoxy-5-hydroxyphenyl)-N-[[2-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methyl]furan-2-carboxamide.
| Compound Name | 5-(3-ethoxy-5-hydroxyphenyl)-N-[[2-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 122699085 |
| Molecular Formula | C32H41N3O7 |
| Molecular Weight | 579.69 g/mol |
| Exact Mass | 579.29 |
| IUPAC Name | 5-(3-ethoxy-5-hydroxyphenyl)-N-[[2-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]heptanoylamino]methyl]furan-2-carboxamide |
| SMILES | CCCCCC(C(=O)NCNC(=O)c1ccc(-c2cc(O)cc(OCC)c2)o1)[C@@H](CC)N(C=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H41N3O7/c1-4-7-9-14-27(28(5-2)35(22-36)41-20-23-12-10-8-11-13-23)31(38)33-21-34-32(39)30-16-15-29(42-30)24-17-25(37)19-26(18-24)40-6-3/h8,10-13,15-19,22,27-28,37H,4-7,9,14,20-21H2,1-3H3,(H,33,38)(H,34,39)/t27?,28-/m1/s1 |
| InChIKey | VBHBLIKFZJHNOE-PLYLYKGUSA-N |
| XLogP | 5.42 |
| TPSA | 130.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.69 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|