C35H45N3O9 — CID 118225847
ethyl 5-ethoxy-3-[5-[[[(2R)-2-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]-2-hydroxybenzoate (PubChem CID 118225847) has the molecular formula C35H45N3O9 and a molecular weight of 651.76 g/mol. Its IUPAC name is ethyl 5-ethoxy-3-[5-[[[(2R)-2-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]-2-hydroxybenzoate.
| Compound Name | ethyl 5-ethoxy-3-[5-[[[(2R)-2-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 118225847 |
| Molecular Formula | C35H45N3O9 |
| Molecular Weight | 651.76 g/mol |
| Exact Mass | 651.32 |
| IUPAC Name | ethyl 5-ethoxy-3-[5-[[[(2R)-2-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]-2-hydroxybenzoate |
| SMILES | CCCCC[C@@H](C(=O)NCNC(=O)c1ccc(-c2cc(OCC)cc(C(=O)OCC)c2O)o1)[C@@H](CC)N(C=O)OCc1ccccc1 |
| InChI | InChI=1S/C35H45N3O9/c1-5-9-11-16-26(29(6-2)38(23-39)46-21-24-14-12-10-13-15-24)33(41)36-22-37-34(42)31-18-17-30(47-31)27-19-25(44-7-3)20-28(32(27)40)35(43)45-8-4/h10,12-15,17-20,23,26,29,40H,5-9,11,16,21-22H2,1-4H3,(H,36,41)(H,37,42)/t26-,29-/m1/s1 |
| InChIKey | PZGYONMBJURORU-GGXMVOPNSA-N |
| XLogP | 5.60 |
| TPSA | 156.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.76 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|