C28H39N3O9 — CID 122699098
ethyl 5-ethoxy-3-[5-[[2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]-2-hydroxybenzoate (PubChem CID 122699098) has the molecular formula C28H39N3O9 and a molecular weight of 561.63 g/mol. Its IUPAC name is ethyl 5-ethoxy-3-[5-[[2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]-2-hydroxybenzoate.
| Compound Name | ethyl 5-ethoxy-3-[5-[[2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 122699098 |
| Molecular Formula | C28H39N3O9 |
| Molecular Weight | 561.63 g/mol |
| Exact Mass | 561.27 |
| IUPAC Name | ethyl 5-ethoxy-3-[5-[[2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]-2-hydroxybenzoate |
| SMILES | CCCCCC(C(=O)NCNC(=O)c1ccc(-c2cc(OCC)cc(C(=O)OCC)c2O)o1)[C@@H](CC)N(O)C=O |
| InChI | InChI=1S/C28H39N3O9/c1-5-9-10-11-19(22(6-2)31(37)17-32)26(34)29-16-30-27(35)24-13-12-23(40-24)20-14-18(38-7-3)15-21(25(20)33)28(36)39-8-4/h12-15,17,19,22,33,37H,5-11,16H2,1-4H3,(H,29,34)(H,30,35)/t19?,22-/m1/s1 |
| InChIKey | PFQRHLNGSVJYEE-AVKWCDSFSA-N |
| XLogP | 3.85 |
| TPSA | 167.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.63 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|