C30H44N3O11P — CID 137361478
[3-ethoxy-5-[5-[[2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]-(2-methylpropanoyloxymethoxy)phosphinic acid (PubChem CID 137361478) has the molecular formula C30H44N3O11P and a molecular weight of 653.67 g/mol. Its IUPAC name is [3-ethoxy-5-[5-[[2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]-(2-methylpropanoyloxymethoxy)phosphinic acid.
| Compound Name | [3-ethoxy-5-[5-[[2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]-(2-methylpropanoyloxymethoxy)phosphinic acid |
|---|---|
| PubChem CID | 137361478 |
| Molecular Formula | C30H44N3O11P |
| Molecular Weight | 653.67 g/mol |
| Exact Mass | 653.27 |
| IUPAC Name | [3-ethoxy-5-[5-[[2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]-(2-methylpropanoyloxymethoxy)phosphinic acid |
| SMILES | CCCCCC(C(=O)NCNC(=O)c1ccc(-c2cc(OCC)cc(P(=O)(O)OCOC(=O)C(C)C)c2)o1)[C@@H](CC)N(O)C=O |
| InChI | InChI=1S/C30H44N3O11P/c1-6-9-10-11-24(25(7-2)33(38)18-34)28(35)31-17-32-29(36)27-13-12-26(44-27)21-14-22(41-8-3)16-23(15-21)45(39,40)43-19-42-30(37)20(4)5/h12-16,18,20,24-25,38H,6-11,17,19H2,1-5H3,(H,31,35)(H,32,36)(H,39,40)/t24?,25-/m1/s1 |
| InChIKey | JFZSYSVDLOBVLA-WUBHUQEYSA-N |
| XLogP | 3.96 |
| TPSA | 193.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.67 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|