C29H40N4O9 — CID 122698923
methyl 2-[[3-ethoxy-5-[5-[[2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]acetate (PubChem CID 122698923) has the molecular formula C29H40N4O9 and a molecular weight of 588.66 g/mol. Its IUPAC name is methyl 2-[[3-ethoxy-5-[5-[[2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]acetate.
| Compound Name | methyl 2-[[3-ethoxy-5-[5-[[2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]acetate |
|---|---|
| PubChem CID | 122698923 |
| Molecular Formula | C29H40N4O9 |
| Molecular Weight | 588.66 g/mol |
| Exact Mass | 588.28 |
| IUPAC Name | methyl 2-[[3-ethoxy-5-[5-[[2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]acetate |
| SMILES | CCCCCC(C(=O)NCNC(=O)c1ccc(-c2cc(OCC)cc(C(=O)NCC(=O)OC)c2)o1)[C@@H](CC)N(O)C=O |
| InChI | InChI=1S/C29H40N4O9/c1-5-8-9-10-22(23(6-2)33(39)18-34)28(37)31-17-32-29(38)25-12-11-24(42-25)19-13-20(15-21(14-19)41-7-3)27(36)30-16-26(35)40-4/h11-15,18,22-23,39H,5-10,16-17H2,1-4H3,(H,30,36)(H,31,37)(H,32,38)/t22?,23-/m1/s1 |
| InChIKey | ASFLJQLPNMYHON-OZAIVSQSSA-N |
| XLogP | 2.87 |
| TPSA | 176.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.66 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|