C31H45N3O10 — CID 147163296
5-[3-ethoxy-5-[4-hydroxy-3,3-bis(hydroxymethyl)butanoyl]phenyl]-N-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methyl]furan-2-carboxamide (PubChem CID 147163296) has the molecular formula C31H45N3O10 and a molecular weight of 619.71 g/mol. Its IUPAC name is 5-[3-ethoxy-5-[4-hydroxy-3,3-bis(hydroxymethyl)butanoyl]phenyl]-N-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methyl]furan-2-carboxamide.
| Compound Name | 5-[3-ethoxy-5-[4-hydroxy-3,3-bis(hydroxymethyl)butanoyl]phenyl]-N-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 147163296 |
| Molecular Formula | C31H45N3O10 |
| Molecular Weight | 619.71 g/mol |
| Exact Mass | 619.31 |
| IUPAC Name | 5-[3-ethoxy-5-[4-hydroxy-3,3-bis(hydroxymethyl)butanoyl]phenyl]-N-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methyl]furan-2-carboxamide |
| SMILES | CCCCC[C@@H](C(=O)NCNC(=O)c1ccc(-c2cc(OCC)cc(C(=O)CC(CO)(CO)CO)c2)o1)[C@@H](CC)N(O)C=O |
| InChI | InChI=1S/C31H45N3O10/c1-4-7-8-9-24(25(5-2)34(42)20-38)29(40)32-19-33-30(41)28-11-10-27(44-28)22-12-21(13-23(14-22)43-6-3)26(39)15-31(16-35,17-36)18-37/h10-14,20,24-25,35-37,42H,4-9,15-19H2,1-3H3,(H,32,40)(H,33,41)/t24-,25-/m1/s1 |
| InChIKey | BWGLOUFINUPSKT-JWQCQUIFSA-N |
| XLogP | 2.51 |
| TPSA | 198.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.71 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|