C35H52N3O14P — CID 145228246
[[3-ethoxy-5-[5-[[2-[1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]-(propan-2-yloxycarbonyloxymethoxy)phosphanyl]oxymethyl propan-2-yl carbonate (PubChem CID 145228246) has the molecular formula C35H52N3O14P and a molecular weight of 769.78 g/mol. Its IUPAC name is [[3-ethoxy-5-[5-[[2-[1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]-(propan-2-yloxycarbonyloxymethoxy)phosphanyl]oxymethyl propan-2-yl carbonate.
| Compound Name | [[3-ethoxy-5-[5-[[2-[1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]-(propan-2-yloxycarbonyloxymethoxy)phosphanyl]oxymethyl propan-2-yl carbonate |
|---|---|
| PubChem CID | 145228246 |
| Molecular Formula | C35H52N3O14P |
| Molecular Weight | 769.78 g/mol |
| Exact Mass | 769.32 |
| IUPAC Name | [[3-ethoxy-5-[5-[[2-[1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]-(propan-2-yloxycarbonyloxymethoxy)phosphanyl]oxymethyl propan-2-yl carbonate |
| SMILES | CCCCCC(C(=O)NCNC(=O)c1ccc(-c2cc(OCC)cc(P(OCOC(=O)OC(C)C)OCOC(=O)OC(C)C)c2)o1)C(CC)N(O)C=O |
| InChI | InChI=1S/C35H52N3O14P/c1-8-11-12-13-28(29(9-2)38(44)20-39)32(40)36-19-37-33(41)31-15-14-30(52-31)25-16-26(45-10-3)18-27(17-25)53(48-21-46-34(42)50-23(4)5)49-22-47-35(43)51-24(6)7/h14-18,20,23-24,28-29,44H,8-13,19,21-22H2,1-7H3,(H,36,40)(H,37,41) |
| InChIKey | AJMMJWHSEMIVMH-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 210.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.78 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|