C26H38N3O7P — CID 145228018
[3-ethoxy-5-[5-[[2-[1-[formyl(methoxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]phosphinous acid (PubChem CID 145228018) has the molecular formula C26H38N3O7P and a molecular weight of 535.58 g/mol. Its IUPAC name is [3-ethoxy-5-[5-[[2-[1-[formyl(methoxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]phosphinous acid.
| Compound Name | [3-ethoxy-5-[5-[[2-[1-[formyl(methoxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]phosphinous acid |
|---|---|
| PubChem CID | 145228018 |
| Molecular Formula | C26H38N3O7P |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | [3-ethoxy-5-[5-[[2-[1-[formyl(methoxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]phosphinous acid |
| SMILES | CCCCCC(C(=O)NCNC(=O)c1ccc(-c2cc(OCC)cc(PO)c2)o1)C(CC)N(C=O)OC |
| InChI | InChI=1S/C26H38N3O7P/c1-5-8-9-10-21(22(6-2)29(17-30)34-4)25(31)27-16-28-26(32)24-12-11-23(36-24)18-13-19(35-7-3)15-20(14-18)37-33/h11-15,17,21-22,33,37H,5-10,16H2,1-4H3,(H,27,31)(H,28,32) |
| InChIKey | ROXDPQGWLRDREV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 130.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|