C34H52N3O10P — CID 137361239
[3-ethoxy-5-[5-[[2-[1-[formyl(nonanoyloxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]phosphonic acid (PubChem CID 137361239) has the molecular formula C34H52N3O10P and a molecular weight of 693.78 g/mol. Its IUPAC name is [3-ethoxy-5-[5-[[2-[1-[formyl(nonanoyloxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]phosphonic acid.
| Compound Name | [3-ethoxy-5-[5-[[2-[1-[formyl(nonanoyloxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 137361239 |
| Molecular Formula | C34H52N3O10P |
| Molecular Weight | 693.78 g/mol |
| Exact Mass | 693.34 |
| IUPAC Name | [3-ethoxy-5-[5-[[2-[1-[formyl(nonanoyloxy)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]phosphonic acid |
| SMILES | CCCCCCCCC(=O)ON(C=O)C(CC)C(CCCCC)C(=O)NCNC(=O)c1ccc(-c2cc(OCC)cc(P(=O)(O)O)c2)o1 |
| InChI | InChI=1S/C34H52N3O10P/c1-5-9-11-12-13-15-17-32(39)47-37(24-38)29(7-3)28(16-14-10-6-2)33(40)35-23-36-34(41)31-19-18-30(46-31)25-20-26(45-8-4)22-27(21-25)48(42,43)44/h18-22,24,28-29H,5-17,23H2,1-4H3,(H,35,40)(H,36,41)(H2,42,43,44) |
| InChIKey | UQAVYKYPXNXPSK-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 184.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.78 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|