C36H47N4O10P — CID 137361430
[3-ethoxy-5-[5-[[2-[1-[formyl-(3-pyrrolidin-1-ylbenzoyl)oxyamino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]phosphonic acid (PubChem CID 137361430) has the molecular formula C36H47N4O10P and a molecular weight of 726.76 g/mol. Its IUPAC name is [3-ethoxy-5-[5-[[2-[1-[formyl-(3-pyrrolidin-1-ylbenzoyl)oxyamino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]phosphonic acid.
| Compound Name | [3-ethoxy-5-[5-[[2-[1-[formyl-(3-pyrrolidin-1-ylbenzoyl)oxyamino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 137361430 |
| Molecular Formula | C36H47N4O10P |
| Molecular Weight | 726.76 g/mol |
| Exact Mass | 726.30 |
| IUPAC Name | [3-ethoxy-5-[5-[[2-[1-[formyl-(3-pyrrolidin-1-ylbenzoyl)oxyamino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]phosphonic acid |
| SMILES | CCCCCC(C(=O)NCNC(=O)c1ccc(-c2cc(OCC)cc(P(=O)(O)O)c2)o1)C(CC)N(C=O)OC(=O)c1cccc(N2CCCC2)c1 |
| InChI | InChI=1S/C36H47N4O10P/c1-4-7-8-14-30(31(5-2)40(24-41)50-36(44)25-12-11-13-27(19-25)39-17-9-10-18-39)34(42)37-23-38-35(43)33-16-15-32(49-33)26-20-28(48-6-3)22-29(21-26)51(45,46)47/h11-13,15-16,19-22,24,30-31H,4-10,14,17-18,23H2,1-3H3,(H,37,42)(H,38,43)(H2,45,46,47) |
| InChIKey | NFKAORRLFYYADB-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 187.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.76 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|