C36H48N3O11P — CID 137361320
[3-ethoxy-5-[5-[[2-[(1R)-1-[formyl-(4-methoxy-2-propan-2-ylbenzoyl)oxyamino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]phosphonic acid (PubChem CID 137361320) has the molecular formula C36H48N3O11P and a molecular weight of 729.76 g/mol. Its IUPAC name is [3-ethoxy-5-[5-[[2-[(1R)-1-[formyl-(4-methoxy-2-propan-2-ylbenzoyl)oxyamino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]phosphonic acid.
| Compound Name | [3-ethoxy-5-[5-[[2-[(1R)-1-[formyl-(4-methoxy-2-propan-2-ylbenzoyl)oxyamino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 137361320 |
| Molecular Formula | C36H48N3O11P |
| Molecular Weight | 729.76 g/mol |
| Exact Mass | 729.30 |
| IUPAC Name | [3-ethoxy-5-[5-[[2-[(1R)-1-[formyl-(4-methoxy-2-propan-2-ylbenzoyl)oxyamino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]phenyl]phosphonic acid |
| SMILES | CCCCCC(C(=O)NCNC(=O)c1ccc(-c2cc(OCC)cc(P(=O)(O)O)c2)o1)[C@@H](CC)N(C=O)OC(=O)c1ccc(OC)cc1C(C)C |
| InChI | InChI=1S/C36H48N3O11P/c1-7-10-11-12-29(31(8-2)39(22-40)50-36(43)28-14-13-25(47-6)20-30(28)23(4)5)34(41)37-21-38-35(42)33-16-15-32(49-33)24-17-26(48-9-3)19-27(18-24)51(44,45)46/h13-20,22-23,29,31H,7-12,21H2,1-6H3,(H,37,41)(H,38,42)(H2,44,45,46)/t29?,31-/m1/s1 |
| InChIKey | RFHGAZLSDXEWHE-ZGVDRVBQSA-N |
| XLogP | 5.29 |
| TPSA | 193.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.76 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|