C41H52N4O13 — CID 137361367
2-[[2-ethoxy-4-[5-[[2-[1-[formyl-(4-methoxy-2-propan-2-ylbenzoyl)oxyamino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]butanedioic acid (PubChem CID 137361367) has the molecular formula C41H52N4O13 and a molecular weight of 808.88 g/mol. Its IUPAC name is 2-[[2-ethoxy-4-[5-[[2-[1-[formyl-(4-methoxy-2-propan-2-ylbenzoyl)oxyamino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-ethoxy-4-[5-[[2-[1-[formyl-(4-methoxy-2-propan-2-ylbenzoyl)oxyamino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 137361367 |
| Molecular Formula | C41H52N4O13 |
| Molecular Weight | 808.88 g/mol |
| Exact Mass | 808.35 |
| IUPAC Name | 2-[[2-ethoxy-4-[5-[[2-[1-[formyl-(4-methoxy-2-propan-2-ylbenzoyl)oxyamino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]butanedioic acid |
| SMILES | CCCCCC(C(=O)NCNC(=O)c1ccc(-c2ccc(C(=O)NC(CC(=O)O)C(=O)O)c(OCC)c2)o1)C(CC)N(C=O)OC(=O)c1ccc(OC)cc1C(C)C |
| InChI | InChI=1S/C41H52N4O13/c1-7-10-11-12-28(32(8-2)45(23-46)58-41(54)27-16-14-26(55-6)20-30(27)24(4)5)37(49)42-22-43-39(51)34-18-17-33(57-34)25-13-15-29(35(19-25)56-9-3)38(50)44-31(40(52)53)21-36(47)48/h13-20,23-24,28,31-32H,7-12,21-22H2,1-6H3,(H,42,49)(H,43,51)(H,44,50)(H,47,48)(H,52,53) |
| InChIKey | KLTUDKDQTPDPQT-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 240.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.88 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|