C38H45N5O13 — CID 137361452
2-[[2-ethoxy-4-[5-[[2-[(1R)-1-[formyl-(2-methyl-4-nitrosobenzoyl)oxyamino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]butanedioic acid (PubChem CID 137361452) has the molecular formula C38H45N5O13 and a molecular weight of 779.80 g/mol. Its IUPAC name is 2-[[2-ethoxy-4-[5-[[2-[(1R)-1-[formyl-(2-methyl-4-nitrosobenzoyl)oxyamino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-ethoxy-4-[5-[[2-[(1R)-1-[formyl-(2-methyl-4-nitrosobenzoyl)oxyamino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 137361452 |
| Molecular Formula | C38H45N5O13 |
| Molecular Weight | 779.80 g/mol |
| Exact Mass | 779.30 |
| IUPAC Name | 2-[[2-ethoxy-4-[5-[[2-[(1R)-1-[formyl-(2-methyl-4-nitrosobenzoyl)oxyamino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]butanedioic acid |
| SMILES | CCCCCC(C(=O)NCNC(=O)c1ccc(-c2ccc(C(=O)NC(CC(=O)O)C(=O)O)c(OCC)c2)o1)[C@@H](CC)N(C=O)OC(=O)c1ccc(N=O)cc1C |
| InChI | InChI=1S/C38H45N5O13/c1-5-8-9-10-26(29(6-2)43(21-44)56-38(52)25-14-12-24(42-53)17-22(25)4)34(47)39-20-40-36(49)31-16-15-30(55-31)23-11-13-27(32(18-23)54-7-3)35(48)41-28(37(50)51)19-33(45)46/h11-18,21,26,28-29H,5-10,19-20H2,1-4H3,(H,39,47)(H,40,49)(H,41,48)(H,45,46)(H,50,51)/t26?,28?,29-/m1/s1 |
| InChIKey | KXYIFHLPMGLBBV-UYTNTSMZSA-N |
| XLogP | 4.72 |
| TPSA | 260.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.80 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|