C40H46N6O12 — CID 137360947
2-[[2-ethoxy-4-[5-[[2-[1-[formyl-(4-pyrazol-1-ylbenzoyl)oxyamino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]butanedioic acid (PubChem CID 137360947) has the molecular formula C40H46N6O12 and a molecular weight of 802.84 g/mol. Its IUPAC name is 2-[[2-ethoxy-4-[5-[[2-[1-[formyl-(4-pyrazol-1-ylbenzoyl)oxyamino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-ethoxy-4-[5-[[2-[1-[formyl-(4-pyrazol-1-ylbenzoyl)oxyamino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 137360947 |
| Molecular Formula | C40H46N6O12 |
| Molecular Weight | 802.84 g/mol |
| Exact Mass | 802.32 |
| IUPAC Name | 2-[[2-ethoxy-4-[5-[[2-[1-[formyl-(4-pyrazol-1-ylbenzoyl)oxyamino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]benzoyl]amino]butanedioic acid |
| SMILES | CCCCCC(C(=O)NCNC(=O)c1ccc(-c2ccc(C(=O)NC(CC(=O)O)C(=O)O)c(OCC)c2)o1)C(CC)N(C=O)OC(=O)c1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C40H46N6O12/c1-4-7-8-10-28(31(5-2)46(24-47)58-40(55)25-11-14-27(15-12-25)45-20-9-19-43-45)36(50)41-23-42-38(52)33-18-17-32(57-33)26-13-16-29(34(21-26)56-6-3)37(51)44-30(39(53)54)22-35(48)49/h9,11-21,24,28,30-31H,4-8,10,22-23H2,1-3H3,(H,41,50)(H,42,52)(H,44,51)(H,48,49)(H,53,54) |
| InChIKey | DBJNEKNPRYNNBL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 248.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.84 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|