C37H45N5O12 — CID 145228066
2-[[4-[5-[[[(2R)-2-[1-[(3-aminobenzoyl)oxy-formylamino]propyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]-2-ethoxybenzoyl]amino]butanedioic acid (PubChem CID 145228066) has the molecular formula C37H45N5O12 and a molecular weight of 751.79 g/mol. Its IUPAC name is 2-[[4-[5-[[[(2R)-2-[1-[(3-aminobenzoyl)oxy-formylamino]propyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]-2-ethoxybenzoyl]amino]butanedioic acid.
| Compound Name | 2-[[4-[5-[[[(2R)-2-[1-[(3-aminobenzoyl)oxy-formylamino]propyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]-2-ethoxybenzoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 145228066 |
| Molecular Formula | C37H45N5O12 |
| Molecular Weight | 751.79 g/mol |
| Exact Mass | 751.31 |
| IUPAC Name | 2-[[4-[5-[[[(2R)-2-[1-[(3-aminobenzoyl)oxy-formylamino]propyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]-2-ethoxybenzoyl]amino]butanedioic acid |
| SMILES | CCCCC[C@@H](C(=O)NCNC(=O)c1ccc(-c2ccc(C(=O)NC(CC(=O)O)C(=O)O)c(OCC)c2)o1)C(CC)N(C=O)OC(=O)c1cccc(N)c1 |
| InChI | InChI=1S/C37H45N5O12/c1-4-7-8-12-25(28(5-2)42(21-43)54-37(51)23-10-9-11-24(38)17-23)33(46)39-20-40-35(48)30-16-15-29(53-30)22-13-14-26(31(18-22)52-6-3)34(47)41-27(36(49)50)19-32(44)45/h9-11,13-18,21,25,27-28H,4-8,12,19-20,38H2,1-3H3,(H,39,46)(H,40,48)(H,41,47)(H,44,45)(H,49,50)/t25-,27?,28?/m1/s1 |
| InChIKey | KDDGIXPHNLLZBL-AJVXGCDVSA-N |
| XLogP | 3.59 |
| TPSA | 256.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.79 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|