C36H50N4O13 — CID 137361756
2-[[4-[5-[[2-[1-[2,2-dimethylpropanoyloxymethoxy(formyl)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]-2-ethoxybenzoyl]amino]butanedioic acid (PubChem CID 137361756) has the molecular formula C36H50N4O13 and a molecular weight of 746.81 g/mol. Its IUPAC name is 2-[[4-[5-[[2-[1-[2,2-dimethylpropanoyloxymethoxy(formyl)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]-2-ethoxybenzoyl]amino]butanedioic acid.
| Compound Name | 2-[[4-[5-[[2-[1-[2,2-dimethylpropanoyloxymethoxy(formyl)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]-2-ethoxybenzoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 137361756 |
| Molecular Formula | C36H50N4O13 |
| Molecular Weight | 746.81 g/mol |
| Exact Mass | 746.34 |
| IUPAC Name | 2-[[4-[5-[[2-[1-[2,2-dimethylpropanoyloxymethoxy(formyl)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]-2-ethoxybenzoyl]amino]butanedioic acid |
| SMILES | CCCCCC(C(=O)NCNC(=O)c1ccc(-c2ccc(C(=O)NC(CC(=O)O)C(=O)O)c(OCC)c2)o1)C(CC)N(C=O)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C36H50N4O13/c1-7-10-11-12-23(26(8-2)40(20-41)52-21-51-35(49)36(4,5)6)31(44)37-19-38-33(46)28-16-15-27(53-28)22-13-14-24(29(17-22)50-9-3)32(45)39-25(34(47)48)18-30(42)43/h13-17,20,23,25-26H,7-12,18-19,21H2,1-6H3,(H,37,44)(H,38,46)(H,39,45)(H,42,43)(H,47,48) |
| InChIKey | MZKJYCMLNFGDOX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 240.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.81 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|