C34H43N4O11P — CID 137361436
[[4-[5-[[2-[1-[benzoyloxy(formyl)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]-2-ethoxybenzoyl]amino]methylphosphonic acid (PubChem CID 137361436) has the molecular formula C34H43N4O11P and a molecular weight of 714.71 g/mol. Its IUPAC name is [[4-[5-[[2-[1-[benzoyloxy(formyl)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]-2-ethoxybenzoyl]amino]methylphosphonic acid.
| Compound Name | [[4-[5-[[2-[1-[benzoyloxy(formyl)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]-2-ethoxybenzoyl]amino]methylphosphonic acid |
|---|---|
| PubChem CID | 137361436 |
| Molecular Formula | C34H43N4O11P |
| Molecular Weight | 714.71 g/mol |
| Exact Mass | 714.27 |
| IUPAC Name | [[4-[5-[[2-[1-[benzoyloxy(formyl)amino]propyl]heptanoylamino]methylcarbamoyl]furan-2-yl]-2-ethoxybenzoyl]amino]methylphosphonic acid |
| SMILES | CCCCCC(C(=O)NCNC(=O)c1ccc(-c2ccc(C(=O)NCP(=O)(O)O)c(OCC)c2)o1)C(CC)N(C=O)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C34H43N4O11P/c1-4-7-9-14-25(27(5-2)38(22-39)49-34(43)23-12-10-8-11-13-23)31(40)35-20-36-33(42)29-18-17-28(48-29)24-15-16-26(30(19-24)47-6-3)32(41)37-21-50(44,45)46/h8,10-13,15-19,22,25,27H,4-7,9,14,20-21H2,1-3H3,(H,35,40)(H,36,42)(H,37,41)(H2,44,45,46) |
| InChIKey | GPLSUJIVKJGVGZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 213.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.71 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|