C34H45N4O10P — CID 118225933
[[2-ethoxy-4-[5-[[[(2R)-2-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]benzoyl]amino]methylphosphonic acid (PubChem CID 118225933) has the molecular formula C34H45N4O10P and a molecular weight of 700.73 g/mol. Its IUPAC name is [[2-ethoxy-4-[5-[[[(2R)-2-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]benzoyl]amino]methylphosphonic acid.
| Compound Name | [[2-ethoxy-4-[5-[[[(2R)-2-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]benzoyl]amino]methylphosphonic acid |
|---|---|
| PubChem CID | 118225933 |
| Molecular Formula | C34H45N4O10P |
| Molecular Weight | 700.73 g/mol |
| Exact Mass | 700.29 |
| IUPAC Name | [[2-ethoxy-4-[5-[[[(2R)-2-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]benzoyl]amino]methylphosphonic acid |
| SMILES | CCCCC[C@@H](C(=O)NCNC(=O)c1ccc(-c2ccc(C(=O)NCP(=O)(O)O)c(OCC)c2)o1)[C@@H](CC)N(C=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H45N4O10P/c1-4-7-9-14-26(28(5-2)38(23-39)47-20-24-12-10-8-11-13-24)32(40)35-21-36-34(42)30-18-17-29(48-30)25-15-16-27(31(19-25)46-6-3)33(41)37-22-49(43,44)45/h8,10-13,15-19,23,26,28H,4-7,9,14,20-22H2,1-3H3,(H,35,40)(H,36,42)(H,37,41)(H2,43,44,45)/t26-,28-/m1/s1 |
| InChIKey | TWTGIEKZVDZLAL-IXCJQBJRSA-N |
| XLogP | 4.58 |
| TPSA | 196.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.73 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|